cis-13-Docosenol (CAS 629-98-1)

cis-13-Docosenol, also known as erucyl alcohol, is a monounsaturated fatty alcohol with the chemical formula CH3(CH2)7CH=CH(CH2)11CH2OH, where the double bond is in the cis configuration at the 13th carbon from the methyl end. This long-chain fatty alcohol is naturally derived from certain plant oils, such as rapeseed and mustard oil, and is notable for its distinctive molecular structure that imparts unique physical and chemical properties. In scientific research, cis-13-Docosenol has been extensively studied for its role in modifying lipid bilayers and membrane fluidity. This compound integrates into cell membranes due to its amphiphilic nature, thereby influencing the packing and order of lipid molecules within the bilayer. This characteristic has led to its use in studies investigating the biophysical properties of cellular membranes, including their phase behavior, permeability, and dynamics. Moreover, cis-13-Docosenol has been utilized in the formulation of liposomes and other nanostructured lipid carriers in research focused on the delivery of molecules of interest into cells, exploiting its ability to alter membrane characteristics to facilitate the encapsulation and controlled release of cargo molecules in non-medical applications such as biochemical studies and material science.